Tetramethyl-1,3-dimethoxydisiloxane
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | S16030 |
---|---|
Product Name | Tetramethyl-1,3-dimethoxydisiloxane |
CAS | 18187-24-1 |
Purity | 97% |
Molecular weight | 194.377 |
IUPAC Name | 3,3,5,5-tetramethyl-2,4,6-trioxa-3,5-disilaheptane |
SMILES | CO[Si](C)(C)O[Si](C)(C)OC |
INCHI Code | InChI=1S/C6H18O3Si2/c1-7-10(3,4)9-11(5,6)8-2/h1-6H3 |
Asymmetric atoms | 0 |
LogP | 0.4954 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 1 |
Concept Codes | Organosilicon |