2-(Diphenylphosphino)ethyltriethoxysilane
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | S08025 |
---|---|
Product Name | 2-(Diphenylphosphino)ethyltriethoxysilane |
Other Names | Diphenyl(2-(triethoxysilyl)ethyl)phosphine |
CAS | 18586-39-5 |
Purity | 97% |
Molecular weight | 376.508 |
IUPAC Name | diphenyl[2-(triethoxysilyl)ethyl]phosphane |
SMILES | CCO[Si](CCP(C1=CC=CC=C1)C1=CC=CC=C1)(OCC)OCC |
INCHI Code | InChI=1S/C20H29O3PSi/c1-4-21-25(22-5-2,23-6-3)18-17-24(19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16H,4-6,17-18H2,1-3H3 |
Asymmetric atoms | 0 |
LogP | 4.9464 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.4 |
Concept Codes | Phenyl, Organosilicon, Phosphine, Trialkoxysilane, Cyclic, Aromatic |