Bis(trimethylsilyl) adipate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | S02450 |
---|---|
Product Name | Bis(trimethylsilyl) adipate |
CAS | 18105-31-2 |
Purity | 98% |
Molecular weight | 290.506 |
IUPAC Name | 1,6-ditrimethylsilyl hexanedioate |
SMILES | C[Si](C)(C)OC(=O)CCCCC(=O)O[Si](C)(C)C |
INCHI Code | InChI=1S/C12H26O4Si2/c1-17(2,3)15-11(13)9-7-8-10-12(14)16-18(4,5)6/h7-10H2,1-6H3 |
Asymmetric atoms | 0 |
LogP | 3.3956 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.8333333 |
Concept Codes | Organosilicon |