Boc-D-Phe(4-cn)-OH
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | M06099 |
---|---|
Product Name | Boc-D-Phe(4-cn)-OH |
Other Names | BOC-4-CYANO-D-PHENYLALANINE (R)-N-Boc-4-Cyanophenylalanine N-Boc-4-Cyano-D-phenylalanine |
CAS | 146727-62-0 |
Purity | 95% |
Molecular weight | 290.319 |
IUPAC Name | (2R)-2-{[(tert-butoxy)carbonyl]amino}-3-(4-cyanophenyl)propanoic acid |
SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)C#N)C(O)=O |
INCHI Code | InChI=1S/C15H18N2O4/c1-15(2,3)21-14(20)17-12(13(18)19)8-10-4-6-11(9-16)7-5-10/h4-7,12H,8H2,1-3H3,(H,17,20)(H,18,19)/t12-/m1/s1 |
Asymmetric atoms | 1 |
LogP | 2.4258087 |
H bond acceptors | 4 |
H bond donors | 2 |
fsp3 | 0.4 |
Concept Codes | Phenyl, Carboxylic acid, Secondary amine, Amine (P+S+T), Nitrile, Chiral, NBOC, Carbamate, Amino acid, Alpha-amino acid, Chiral carboxylic acid, Cyclic, Aromatic, Benzonitrile |