6-Methoxypicolinohydrazide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F987749 |
---|---|
Product Name | 6-Methoxypicolinohydrazide |
CAS | 855784-42-8 |
Purity | 98+% |
Molecular weight | 167.168 |
IUPAC Name | 6-methoxypyridine-2-carbohydrazide |
SMILES | COC1=CC=CC(=N1)C(=O)NN |
INCHI Code | InChI=1S/C7H9N3O2/c1-12-6-4-2-3-5(9-6)7(11)10-8/h2-4H,8H2,1H3,(H,10,11) |
Asymmetric atoms | 0 |
LogP | 0.13237458 |
H bond acceptors | 4 |
H bond donors | 2 |
fsp3 | 0.14285715 |
Concept Codes | Alkyne, Methoxy, Ether, Heterocycle, Heteroaromatic, Hydrazide, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |