(3R,4S,5S)-tert-butyl 4-((S)-2-amino-N,3-dimethylbutanamido)-3-methoxy-5-methylheptanoate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F987186 |
---|---|
Product Name | (3R,4S,5S)-tert-butyl 4-((S)-2-amino-N,3-dimethylbutanamido)-3-methoxy-5-methylheptanoate |
CAS | 177423-00-6 |
Purity | 98% |
Molecular weight | 358.523 |
IUPAC Name | tert-butyl (3R,4S,5S)-4-[(2S)-2-amino-N,3-dimethylbutanamido]-3-methoxy-5-methylheptanoate |
SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)OC(C)(C)C)OC)N(C)C(=O)[C@@H](N)C(C)C |
INCHI Code | InChI=1S/C19H38N2O4/c1-10-13(4)17(21(8)18(23)16(20)12(2)3)14(24-9)11-15(22)25-19(5,6)7/h12-14,16-17H,10-11,20H2,1-9H3/t13-,14+,16-,17-/m0/s1 |
Asymmetric atoms | 4 |
LogP | 2.6254737 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.8947368 |
Concept Codes | Ester, Methoxy, Ether, Amide, Primary amine, Amine (P+S+T), Chiral, N-methyl, Amino acid ester, Chiral amide, Chiral amine |