2,4(1H,3H)-Pyrimidinedione, 1-(4-bromo-2-ethylphenyl)dihydro-
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F983275 |
---|---|
Product Name | 2,4(1H,3H)-Pyrimidinedione, 1-(4-bromo-2-ethylphenyl)dihydro- |
CAS | 1539087-46-1 |
Molecular weight | 297.152 |
IUPAC Name | 1-(4-bromo-2-ethylphenyl)-1,3-diazinane-2,4-dione |
SMILES | CCC1=C(C=CC(Br)=C1)N1CCC(=O)NC1=O |
INCHI Code | InChI=1S/C12H13BrN2O2/c1-2-8-7-9(13)3-4-10(8)15-6-5-11(16)14-12(15)17/h3-4,7H,2,5-6H2,1H3,(H,14,16,17) |
Asymmetric atoms | 0 |
LogP | 2.3951695 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.33333334 |
Concept Codes | Phenyl, Heterocycle, Bromo, Halo, Ethyl, Lactam, 6-Membered heterocycle, Disubstituted (3,4)- monobromobenzene, Monobromobenzene, Cyclic, Aromatic |