1,4-Bis(p-tolylamino)anthracene-9,10-dione
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F862905 |
---|---|
Product Name | 1,4-Bis(p-tolylamino)anthracene-9,10-dione |
CAS | 128-80-3 |
Purity | 97% |
Molecular weight | 418.496 |
IUPAC Name | 1,4-bis[(4-methylphenyl)amino]-9,10-dihydroanthracene-9,10-dione |
SMILES | CC1=CC=C(NC2=CC=C(NC3=CC=C(C)C=C3)C3=C2C(=O)C2=CC=CC=C2C3=O)C=C1 |
INCHI Code | InChI=1S/C28H22N2O2/c1-17-7-11-19(12-8-17)29-23-15-16-24(30-20-13-9-18(2)10-14-20)26-25(23)27(31)21-5-3-4-6-22(21)28(26)32/h3-16,29-30H,1-2H3 |
Asymmetric atoms | 0 |
LogP | 9.425401 |
H bond acceptors | 4 |
H bond donors | 2 |
fsp3 | 0.071428575 |
Concept Codes | Phenyl, Ketone, Secondary amine, Amine (P+S+T), Methyl, Tolyl, Diamine, Dimethyl, Cyclic, Aromatic, Anthraquinone |