6-ethyl-5-fluoro-3,4-dihydropyrimidin-4-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F800307 |
---|---|
Product Name | 6-ethyl-5-fluoro-3,4-dihydropyrimidin-4-one |
Other Names | 4-Ethyl-5-fluoro-6-hydroxypyrimidine |
CAS | 137234-87-8 |
Purity | 95% |
Molecular weight | 142.133 |
IUPAC Name | 6-ethyl-5-fluoro-3,4-dihydropyrimidin-4-one |
SMILES | CCC1=C(F)C(=O)NC=N1 |
INCHI Code | InChI=1S/C6H7FN2O/c1-2-4-5(7)6(10)9-3-8-4/h3H,2H2,1H3,(H,8,9,10) |
Asymmetric atoms | 0 |
LogP | -0.17741132 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.33333334 |
Concept Codes | Heterocycle, Heteroaromatic, Fluoro, Halo, Ethyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyrimidine, Cyclic, Aromatic |