5-Bromo-2-chloro-4-fluorobenzoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F790736 |
---|---|
Product Name | 5-Bromo-2-chloro-4-fluorobenzoic acid |
CAS | 1204219-98-6 |
Purity | 98% |
Molecular weight | 253.45 |
IUPAC Name | 5-bromo-2-chloro-4-fluorobenzoic acid |
SMILES | OC(=O)C1=C(Cl)C=C(F)C(Br)=C1 |
INCHI Code | InChI=1S/C7H3BrClFO2/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2H,(H,11,12) |
Asymmetric atoms | 0 |
LogP | 3.146328 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Carboxylic acid, Fluoro, Chloro, Bromo, Halo, Monobromobenzene, Monochlorobenzene, Monofluorobenzene, Trisubstituted (2,4,5)- monobromobenzene, Trisubstituted (2,4,5)- monochlorobenzene, Trisubstituted (2,4,5)- monofluorobenzene, Cyclic, Aromatic, Benzoic acid |