N-(2,6-dimethylphenyl)-1H-benzo[d]imidazol-2-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F789567 |
---|---|
Product Name | N-(2,6-dimethylphenyl)-1H-benzo[d]imidazol-2-amine |
CAS | 435280-98-1 |
Purity | 98% |
Molecular weight | 237.306 |
IUPAC Name | N-(2,6-dimethylphenyl)-1H-1,3-benzodiazol-2-amine |
SMILES | CC1=CC=CC(C)=C1NC1=NC2=CC=CC=C2N1 |
INCHI Code | InChI=1S/C15H15N3/c1-10-6-5-7-11(2)14(10)18-15-16-12-8-3-4-9-13(12)17-15/h3-9H,1-2H3,(H2,16,17,18) |
Asymmetric atoms | 0 |
LogP | 4.4105225 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.13333334 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Methyl, Tolyl, Dimethyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Benzimidazole, Cyclic, Aromatic |