2-[2-Trifluoroethoxyphenoxy]ethyl methanesulfonate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F789166 |
---|---|
Product Name | 2-[2-Trifluoroethoxyphenoxy]ethyl methanesulfonate |
CAS | 160969-03-9 |
Purity | 97% |
Molecular weight | 314.28 |
IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl methanesulfonate |
SMILES | CS(=O)(=O)OCCOC1=CC=CC=C1OCC(F)(F)F |
INCHI Code | InChI=1S/C11H13F3O5S/c1-20(15,16)19-7-6-17-9-4-2-3-5-10(9)18-8-11(12,13)14/h2-5H,6-8H2,1H3 |
Asymmetric atoms | 0 |
LogP | 1.8590617 |
H bond acceptors | 4 |
H bond donors | 0 |
fsp3 | 0.45454547 |
Concept Codes | Phenyl, Ether, Fluoro, Halo, Trifluoromethyl, Sulfonate, Cyclic, Aromatic, PEG-2, PFA01, PFA02 |