(R)-2-methoxy-N-(1-(4-(trifluoromethoxy)phenyl)ethyl)acetamide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F788998 |
---|---|
Product Name | (R)-2-methoxy-N-(1-(4-(trifluoromethoxy)phenyl)ethyl)acetamide |
CAS | 1391496-87-9 |
Purity | 98% |
Molecular weight | 277.243 |
IUPAC Name | 2-methoxy-N-[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide |
SMILES | COCC(=O)N[C@H](C)C1=CC=C(OC(F)(F)F)C=C1 |
INCHI Code | InChI=1/C12H14F3NO3/c1-8(16-11(17)7-18-2)9-3-5-10(6-4-9)19-12(13,14)15/h3-6,8H,7H2,1-2H3,(H,16,17)/t8-/s2 |
Asymmetric atoms | 1 |
LogP | 2.591426 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.41666666 |
Concept Codes | Phenyl, Methoxy, Ether, Amide, Fluoro, Halo, Chiral, Trifluoromethyl, Trifluoromethoxy, Chiral amide, Trifluoromethoxy benzene, Cyclic, Aromatic, PFA01, PFA02, PFA03 |