1-Allyl-3-(4-phenoxyphenyl)thiourea
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F787758 |
---|---|
Product Name | 1-Allyl-3-(4-phenoxyphenyl)thiourea |
CAS | 433253-68-0 |
Purity | 98% |
Molecular weight | 284.38 |
IUPAC Name | 1-(4-phenoxyphenyl)-3-(prop-2-en-1-yl)thiourea |
SMILES | C=CCNC(=S)NC1=CC=C(OC2=CC=CC=C2)C=C1 |
INCHI Code | InChI=1S/C16H16N2OS/c1-2-12-17-16(20)18-13-8-10-15(11-9-13)19-14-6-4-3-5-7-14/h2-11H,1,12H2,(H2,17,18,20) |
Asymmetric atoms | 0 |
LogP | 4.222493 |
H bond acceptors | 0 |
H bond donors | 2 |
fsp3 | 0.0625 |
Concept Codes | Phenyl, Ether, Alkene, Thiourea, Cyclic, Aromatic, Diphenyl ether |