Methyl 2-amino-6-methoxyisonicotinate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F787201 |
---|---|
Product Name | Methyl 2-amino-6-methoxyisonicotinate |
CAS | 2090069-09-1 |
Purity | 98% |
Molecular weight | 182.179 |
IUPAC Name | methyl 2-amino-6-methoxypyridine-4-carboxylate |
SMILES | COC(=O)C1=CC(OC)=NC(N)=C1 |
INCHI Code | InChI=1S/C8H10N2O3/c1-12-7-4-5(8(11)13-2)3-6(9)10-7/h3-4H,1-2H3,(H2,9,10) |
Asymmetric atoms | 0 |
LogP | 0.9613682 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.25 |
Concept Codes | Ester, Methoxy, Ether, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Amino acid ester, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |