Imidazo[1,5-a]pyridin-7-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F785477 |
---|---|
Product Name | Imidazo[1,5-a]pyridin-7-amine |
CAS | 1513258-12-2 |
Purity | 98% |
Molecular weight | 133.154 |
IUPAC Name | imidazo[1,5-a]pyridin-7-amine |
SMILES | NC1=CC2=CN=CN2C=C1 |
INCHI Code | InChI=1S/C7H7N3/c8-6-1-2-10-5-9-4-7(10)3-6/h1-5H,8H2 |
Asymmetric atoms | 0 |
LogP | -0.41752028 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.0 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heteroaromatic, 6-Membered heterocycle, Cyclic, Aromatic |