tert-Butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-azaspiro[3.3]hept-5-ene-2-carboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F781779 |
---|---|
Product Name | tert-Butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-azaspiro[3.3]hept-5-ene-2-carboxylate |
CAS | 2730903-90-7 |
Purity | 98% |
Molecular weight | 321.22 |
IUPAC Name | tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-azaspiro[3.3]hept-5-ene-2-carboxylate |
SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(=C2)B1OC(C)(C)C(C)(C)O1 |
INCHI Code | InChI=1S/C17H28BNO4/c1-14(2,3)21-13(20)19-10-17(11-19)8-12(9-17)18-22-15(4,5)16(6,7)23-18/h8H,9-11H2,1-7H3 |
Asymmetric atoms | 0 |
LogP | 2.6369 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.8235294 |
Concept Codes | Heterocycle, Tertiary amine, Amine (P+S+T), Methyl, NBOC, Boronic ester, Pinacol boronate, 4-Membered heterocycle, Spirocycle, Cyclic, 1,3,2-Dioxaborolane |