(S)-2-Amino-3-methylbutanenitrile
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F779946 |
---|---|
Product Name | (S)-2-Amino-3-methylbutanenitrile |
CAS | 105452-73-1 |
Purity | 98% |
Molecular weight | 98.149 |
IUPAC Name | (2S)-2-amino-3-methylbutanenitrile |
SMILES | CC(C)[C@H](N)C#N |
INCHI Code | InChI=1/C5H10N2/c1-4(2)5(7)3-6/h4-5H,7H2,1-2H3/t5-/s2 |
Asymmetric atoms | 1 |
LogP | 0.36673278 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.8 |
Concept Codes | Primary amine, Amine (P+S+T), Nitrile, Chiral, Chiral amine |