4-Cyclohexyloxazolidine-2,5-dione
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F777447 |
---|---|
Product Name | 4-Cyclohexyloxazolidine-2,5-dione |
CAS | 872806-48-9 |
Purity | 98% |
Molecular weight | 183.207 |
IUPAC Name | 4-cyclohexyl-1,3-oxazolidine-2,5-dione |
SMILES | O=C1NC(C2CCCCC2)C(=O)O1 |
INCHI Code | InChI=1/C9H13NO3/c11-8-7(10-9(12)13-8)6-4-2-1-3-5-6/h6-7H,1-5H2,(H,10,12) |
Asymmetric atoms | 1 |
LogP | 1.6051797 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.7777778 |
Concept Codes | Heterocycle, Lactam, Lactone, 5-Membered heterocycle, Cyclohexane, Cyclic, Oxazolidine, Alpha-amino acid |