2-(Dimethylamino)-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F776738 |
---|---|
Product Name | 2-(Dimethylamino)-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide |
Other Names | 2-(dimethylamino)-N-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
CAS | 873306-31-1 |
Purity | 98% |
Molecular weight | 304.2 |
IUPAC Name | 2-(dimethylamino)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
SMILES | CN(C)CC(=O)NC1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 |
INCHI Code | InChI=1S/C16H25BN2O3/c1-15(2)16(3,4)22-17(21-15)12-7-9-13(10-8-12)18-14(20)11-19(5)6/h7-10H,11H2,1-6H3,(H,18,20) |
Asymmetric atoms | 0 |
LogP | 3.0925 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.5625 |
Concept Codes | Phenyl, Amide, Tertiary amine, Amine (P+S+T), Methyl, N-methyl, Boronic ester, Pinacol boronate, Cyclic, Aromatic, Phenylboronic acid ester, Phenylboronic acid pinacol ester, 1,3,2-Dioxaborolane |