Tert-butyl (6-(aminomethyl)pyridin-3-yl)carbamate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F776713 |
---|---|
Product Name | Tert-butyl (6-(aminomethyl)pyridin-3-yl)carbamate |
CAS | 871471-00-0 |
Purity | 98% |
Molecular weight | 223.276 |
IUPAC Name | tert-butyl N-[6-(aminomethyl)pyridin-3-yl]carbamate |
SMILES | CC(C)(C)OC(=O)NC1=CN=C(CN)C=C1 |
INCHI Code | InChI=1S/C11H17N3O2/c1-11(2,3)16-10(15)14-9-5-4-8(6-12)13-7-9/h4-5,7H,6,12H2,1-3H3,(H,14,15) |
Asymmetric atoms | 0 |
LogP | 0.8737749 |
H bond acceptors | 4 |
H bond donors | 2 |
fsp3 | 0.45454547 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Secondary amine, Amine (P+S+T), NBOC, Carbamate, Diamine, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |