5-(ethoxymethyl)pyridin-2-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F775984 |
---|---|
Product Name | 5-(ethoxymethyl)pyridin-2-amine |
CAS | 782431-91-8 |
Purity | 98% |
Molecular weight | 152.197 |
IUPAC Name | 5-(ethoxymethyl)pyridin-2-amine |
SMILES | CCOCC1=CC=C(N)N=C1 |
INCHI Code | InChI=1S/C8H12N2O/c1-2-11-6-7-3-4-8(9)10-5-7/h3-5H,2,6H2,1H3,(H2,9,10) |
Asymmetric atoms | 0 |
LogP | 0.75368965 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.375 |
Concept Codes | Ether, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |