1-(4-(Dimethylamino)phenyl)-2,2,2-trifluoroethan-1-ol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F775906 |
---|---|
Product Name | 1-(4-(Dimethylamino)phenyl)-2,2,2-trifluoroethan-1-ol |
Other Names | 1-(4-(Dimethylamino)phenyl)-2,2,2-trifluoroethanol |
CAS | 75822-13-8 |
Purity | 98% |
Molecular weight | 219.207 |
IUPAC Name | 1-[4-(dimethylamino)phenyl]-2,2,2-trifluoroethan-1-ol |
SMILES | CN(C)C1=CC=C(C=C1)C(O)C(F)(F)F |
INCHI Code | InChI=1/C10H12F3NO/c1-14(2)8-5-3-7(4-6-8)9(15)10(11,12)13/h3-6,9,15H,1-2H3 |
Asymmetric atoms | 1 |
LogP | 2.3288033 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.4 |
Concept Codes | Phenyl, Aliphatic alcohol, Tertiary amine, Amine (P+S+T), Fluoro, Halo, N-methyl, Trifluoromethyl, Cyclic, Aromatic, PFA01, PFA02 |