1,2,3,4,4A,9a-hexahydrobenzofuro[2,3-c]pyridine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F775423 |
---|---|
Product Name | 1,2,3,4,4A,9a-hexahydrobenzofuro[2,3-c]pyridine |
CAS | 6783-76-2 |
Purity | 98% |
Molecular weight | 175.231 |
IUPAC Name | 8-oxa-5-azatricyclo[7.4.0.0²,⁷]trideca-1(13),9,11-triene |
SMILES | C1CC2C(CN1)OC1=CC=CC=C21 |
INCHI Code | InChI=1/C11H13NO/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-4,9,11-12H,5-7H2 |
Asymmetric atoms | 2 |
LogP | 1.4422667 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.45454547 |
Concept Codes | Ether, Heterocycle, Secondary amine, Amine (P+S+T), 5-Membered heterocycle, 6-Membered heterocycle, Cyclic, Aromatic |