Methyl 5,6,7,8-tetrahydronaphthalene-1-carboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F775279 |
---|---|
Product Name | Methyl 5,6,7,8-tetrahydronaphthalene-1-carboxylate |
CAS | 66193-59-7 |
Purity | 98% |
Molecular weight | 190.242 |
IUPAC Name | methyl 5,6,7,8-tetrahydronaphthalene-1-carboxylate |
SMILES | COC(=O)C1=CC=CC2=C1CCCC2 |
INCHI Code | InChI=1S/C12H14O2/c1-14-12(13)11-8-4-6-9-5-2-3-7-10(9)11/h4,6,8H,2-3,5,7H2,1H3 |
Asymmetric atoms | 0 |
LogP | 3.428977 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.41666666 |
Concept Codes | Ester, Cyclic, Aromatic, Tetralin |