3-Cyclopropyl-3-(3-hydroxyphenyl)propanoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F773252 |
---|---|
Product Name | 3-Cyclopropyl-3-(3-hydroxyphenyl)propanoic acid |
CAS | 1142224-60-9 |
Purity | 98% |
Molecular weight | 206.241 |
IUPAC Name | 3-cyclopropyl-3-(3-hydroxyphenyl)propanoic acid |
SMILES | OC(=O)CC(C1CC1)C1=CC(O)=CC=C1 |
INCHI Code | InChI=1/C12H14O3/c13-10-3-1-2-9(6-10)11(7-12(14)15)8-4-5-8/h1-3,6,8,11,13H,4-5,7H2,(H,14,15) |
Asymmetric atoms | 1 |
LogP | 2.3068783 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.41666666 |
Concept Codes | Phenyl, Carboxylic acid, Aromatic alcohol, Phenol, Cyclic, Aromatic, Cyclopropane |