1-Methyl-1,2,3,6-tetrahydropyridine-4-carbonitrile
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F773009 |
---|---|
Product Name | 1-Methyl-1,2,3,6-tetrahydropyridine-4-carbonitrile |
CAS | 33495-33-9 |
Purity | 98% |
Molecular weight | 122.171 |
IUPAC Name | 1-methyl-1,2,3,6-tetrahydropyridine-4-carbonitrile |
SMILES | CN1CCC(=CC1)C#N |
INCHI Code | InChI=1S/C7H10N2/c1-9-4-2-7(6-8)3-5-9/h2H,3-5H2,1H3 |
Asymmetric atoms | 0 |
LogP | 0.4941908 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.5714286 |
Concept Codes | Heterocycle, Tertiary amine, Amine (P+S+T), Nitrile, N-methyl, Cyclic |