Tert-butyl ((2-oxoindolin-3-yl)methyl)carbamate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F772700 |
---|---|
Product Name | Tert-butyl ((2-oxoindolin-3-yl)methyl)carbamate |
CAS | 1086392-48-4 |
Purity | 98% |
Molecular weight | 262.309 |
IUPAC Name | tert-butyl N-[(2-oxo-2,3-dihydro-1H-indol-3-yl)methyl]carbamate |
SMILES | CC(C)(C)OC(=O)NCC1C(=O)NC2=CC=CC=C12 |
INCHI Code | InChI=1/C14H18N2O3/c1-14(2,3)19-13(18)15-8-10-9-6-4-5-7-11(9)16-12(10)17/h4-7,10H,8H2,1-3H3,(H,15,18)(H,16,17) |
Asymmetric atoms | 1 |
LogP | 1.7194809 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.42857143 |
Concept Codes | Heterocycle, Amide, Secondary amine, Amine (P+S+T), NBOC, Lactam, Carbamate, 5-Membered heterocycle, Cyclic, Aromatic, Indoline, Oxindole |