2-Amino-3-(2-cyanophenyl)propanoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F772508 |
---|---|
Product Name | 2-Amino-3-(2-cyanophenyl)propanoic acid |
Other Names | 2-CYANO-DL-PHENYLALANINE DL-2-Cyanophenylalanine |
CAS | 263396-40-3 |
Purity | 98% |
Molecular weight | 190.202 |
IUPAC Name | 2-amino-3-(2-cyanophenyl)propanoic acid |
SMILES | NC(CC1=CC=CC=C1C#N)C(O)=O |
INCHI Code | InChI=1/C10H10N2O2/c11-6-8-4-2-1-3-7(8)5-9(12)10(13)14/h1-4,9H,5,12H2,(H,13,14) |
Asymmetric atoms | 1 |
LogP | -1.3288926 |
H bond acceptors | 4 |
H bond donors | 2 |
fsp3 | 0.2 |
Concept Codes | Phenyl, Carboxylic acid, Primary amine, Amine (P+S+T), Nitrile, Amino acid, Alpha-amino acid, Cyclic, Aromatic, Benzonitrile |