2-(4-(1,1-Difluoroethyl)piperidin-1-yl)acetic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F771534 |
---|---|
Product Name | 2-(4-(1,1-Difluoroethyl)piperidin-1-yl)acetic acid |
CAS | 1949816-63-0 |
Purity | 98% |
Molecular weight | 207.221 |
IUPAC Name | 2-[4-(1,1-difluoroethyl)piperidin-1-yl]acetic acid |
SMILES | CC(F)(F)C1CCN(CC(O)=O)CC1 |
INCHI Code | InChI=1S/C9H15F2NO2/c1-9(10,11)7-2-4-12(5-3-7)6-8(13)14/h7H,2-6H2,1H3,(H,13,14) |
Asymmetric atoms | 0 |
LogP | -1.9864969 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.8888889 |
Concept Codes | Carboxylic acid, Heterocycle, Tertiary amine, Amine (P+S+T), Fluoro, Halo, Amino acid, 6-Membered heterocycle, Piperidine, Cyclic, PFA02 |