4,5,6-Trimethoxy-1H-indole-2-carbaldehyde
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F771349 |
---|---|
Product Name | 4,5,6-Trimethoxy-1H-indole-2-carbaldehyde |
CAS | 1779130-25-4 |
Purity | 98% |
Molecular weight | 235.239 |
IUPAC Name | 4,5,6-trimethoxy-1H-indole-2-carbaldehyde |
SMILES | COC1=C(OC)C(OC)=C2C=C(NC2=C1)C=O |
INCHI Code | InChI=1S/C12H13NO4/c1-15-10-5-9-8(4-7(6-14)13-9)11(16-2)12(10)17-3/h4-6,13H,1-3H3 |
Asymmetric atoms | 0 |
LogP | 1.2314975 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.25 |
Concept Codes | Aldehyde, Methoxy, Ether, Heterocycle, Heteroaromatic, 5-Membered heteroaromatic, 5-Membered heterocycle, Indole, Cyclic, Aromatic |