1-(Bromomethyl)-4-(4-isopropylphenoxy)benzene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F769610 |
---|---|
Product Name | 1-(Bromomethyl)-4-(4-isopropylphenoxy)benzene |
CAS | 1427461-07-1 |
Purity | 98% |
Molecular weight | 305.215 |
IUPAC Name | 1-[4-(bromomethyl)phenoxy]-4-(propan-2-yl)benzene |
SMILES | CC(C)C1=CC=C(OC2=CC=C(CBr)C=C2)C=C1 |
INCHI Code | InChI=1S/C16H17BrO/c1-12(2)14-5-9-16(10-6-14)18-15-7-3-13(11-17)4-8-15/h3-10,12H,11H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 5.4912796 |
H bond acceptors | 0 |
H bond donors | 0 |
fsp3 | 0.25 |
Concept Codes | Phenyl, Ether, Bromo, Halo, Cyclic, Aromatic, Benzyl bromide, Diphenyl ether |