6-Methyl-[2,3'-bipyridine]-5'-carbaldehyde
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F768660 |
---|---|
Product Name | 6-Methyl-[2,3'-bipyridine]-5'-carbaldehyde |
CAS | 1346686-85-8 |
Purity | 98% |
Molecular weight | 198.225 |
IUPAC Name | 6-methyl-[2,3'-bipyridine]-5'-carbaldehyde |
SMILES | CC1=NC(=CC=C1)C1=CN=CC(C=O)=C1 |
INCHI Code | InChI=1S/C12H10N2O/c1-9-3-2-4-12(14-9)11-5-10(8-15)6-13-7-11/h2-8H,1H3 |
Asymmetric atoms | 0 |
LogP | 1.4148492 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.083333336 |
Concept Codes | Aldehyde, Heterocycle, Heteroaromatic, Methyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |