2-(Trifluoromethyl)quinoline-5-carbaldehyde
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F767741 |
---|---|
Product Name | 2-(Trifluoromethyl)quinoline-5-carbaldehyde |
CAS | 1260672-09-0 |
Purity | 98% |
Molecular weight | 225.17 |
IUPAC Name | 2-(trifluoromethyl)quinoline-5-carbaldehyde |
SMILES | FC(F)(F)C1=CC=C2C(C=O)=CC=CC2=N1 |
INCHI Code | InChI=1S/C11H6F3NO/c12-11(13,14)10-5-4-8-7(6-16)2-1-3-9(8)15-10/h1-6H |
Asymmetric atoms | 0 |
LogP | 3.1071017 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.09090909 |
Concept Codes | Aldehyde, Heterocycle, Heteroaromatic, Fluoro, Halo, Trifluoromethyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Quinoline, Cyclic, Aromatic, PFA01, PFA02 |