4-(2-(Cyclopropylmethoxy)ethyl)piperidine hydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F767301 |
---|---|
Product Name | 4-(2-(Cyclopropylmethoxy)ethyl)piperidine hydrochloride |
CAS | 1219967-17-5 |
Purity | 98% |
Molecular weight | 219.75 |
IUPAC Name | 4-[2-(cyclopropylmethoxy)ethyl]piperidine hydrochloride |
SMILES | Cl.C(CC1CCNCC1)OCC1CC1 |
INCHI Code | InChI=1S/C11H21NO.ClH/c1-2-11(1)9-13-8-5-10-3-6-12-7-4-10;/h10-12H,1-9H2;1H |
Asymmetric atoms | 0 |
LogP | 1.3761005 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 1 |
Concept Codes | Ether, Heterocycle, Secondary amine, Amine (P+S+T), Hydrochloride, 6-Membered heterocycle, Piperidine, Cyclic, Cyclopropane |