3-(2-(Methylamino)-2-oxoethoxy)benzoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F765384 |
---|---|
Product Name | 3-(2-(Methylamino)-2-oxoethoxy)benzoic acid |
CAS | 1016673-25-8 |
Purity | 98% |
Molecular weight | 209.201 |
IUPAC Name | 3-[(methylcarbamoyl)methoxy]benzoic acid |
SMILES | CNC(=O)COC1=CC=CC(=C1)C(O)=O |
INCHI Code | InChI=1S/C10H11NO4/c1-11-9(12)6-15-8-4-2-3-7(5-8)10(13)14/h2-5H,6H2,1H3,(H,11,12)(H,13,14) |
Asymmetric atoms | 0 |
LogP | 0.3678742 |
H bond acceptors | 4 |
H bond donors | 2 |
fsp3 | 0.2 |
Concept Codes | Phenyl, Carboxylic acid, Ether, Amide, N-methyl, Cyclic, Aromatic, Benzoic acid |