(R)-1-(2,5-Dichlorophenyl)ethanol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F764466 |
---|---|
Product Name | (R)-1-(2,5-Dichlorophenyl)ethanol |
CAS | 1212133-29-3 |
Purity | 98% |
Molecular weight | 191.05 |
IUPAC Name | (1R)-1-(2,5-dichlorophenyl)ethan-1-ol |
SMILES | C[C@@H](O)C1=C(Cl)C=CC(Cl)=C1 |
INCHI Code | InChI=1/C8H8Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-5,11H,1H3/t5-/s2 |
Asymmetric atoms | 1 |
LogP | 2.8305604 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.25 |
Concept Codes | Phenyl, Aliphatic alcohol, Chloro, Halo, Chiral, 1,4-Dichlorobenzene, Chiral alcohol, Dichlorobenzene, Cyclic, Aromatic |