tert-Butyl 4-fluoro-1-oxo-1,3-dihydrospiro[indene-2,4'-piperidine]-1'-carboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F763843 |
---|---|
Product Name | tert-Butyl 4-fluoro-1-oxo-1,3-dihydrospiro[indene-2,4'-piperidine]-1'-carboxylate |
CAS | 2377354-94-2 |
Purity | 98% |
Molecular weight | 319.376 |
IUPAC Name | tert-butyl 7-fluoro-3-oxo-1,3-dihydrospiro[indene-2,4'-piperidine]-1'-carboxylate |
SMILES | CC(C)(C)OC(=O)N1CCC2(CC3=C(F)C=CC=C3C2=O)CC1 |
INCHI Code | InChI=1S/C18H22FNO3/c1-17(2,3)23-16(22)20-9-7-18(8-10-20)11-13-12(15(18)21)5-4-6-14(13)19/h4-6H,7-11H2,1-3H3 |
Asymmetric atoms | 0 |
LogP | 3.2215073 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.5555556 |
Concept Codes | Ketone, Heterocycle, Tertiary amine, Amine (P+S+T), Fluoro, Halo, NBOC, 6-Membered heterocycle, Spirocycle, Cyclic, Aromatic |