tert-Butyl (3-(2-bromoethyl)phenyl)carbamate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F762339 |
---|---|
Product Name | tert-Butyl (3-(2-bromoethyl)phenyl)carbamate |
Other Names | 3-(Boc-amino)phenethylbromide |
CAS | 1026069-85-1 |
Purity | 95% |
Molecular weight | 300.196 |
IUPAC Name | tert-butyl N-[3-(2-bromoethyl)phenyl]carbamate |
SMILES | CC(C)(C)OC(=O)NC1=CC(CCBr)=CC=C1 |
INCHI Code | InChI=1S/C13H18BrNO2/c1-13(2,3)17-12(16)15-11-6-4-5-10(9-11)7-8-14/h4-6,9H,7-8H2,1-3H3,(H,15,16) |
Asymmetric atoms | 0 |
LogP | 3.9456055 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.46153846 |
Concept Codes | Phenyl, Secondary amine, Amine (P+S+T), Bromo, Halo, NBOC, Carbamate, Cyclic, Aromatic |