(2-Amino-5-chloropyridin-3-yl)methanol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F761809 |
---|---|
Product Name | (2-Amino-5-chloropyridin-3-yl)methanol |
CAS | 1339100-79-6 |
Purity | 97% |
Molecular weight | 158.59 |
IUPAC Name | (2-amino-5-chloropyridin-3-yl)methanol |
SMILES | NC1=C(CO)C=C(Cl)C=N1 |
INCHI Code | InChI=1S/C6H7ClN2O/c7-5-1-4(3-10)6(8)9-2-5/h1-2,10H,3H2,(H2,8,9) |
Asymmetric atoms | 0 |
LogP | 0.3577999 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.16666667 |
Concept Codes | Halopyridine, Aliphatic alcohol, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Chloro, Halo, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |