4-Hexyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbaldehyde
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F758226 |
---|---|
Product Name | 4-Hexyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbaldehyde |
Other Names | 2-(4,4,5,5-tetramethy-1,3,2-dioxaborolan-2-yl)-3-hexylthiophene-5-carbaldehyde |
CAS | 1402132-40-4 |
Purity | 98% |
Molecular weight | 322.27 |
IUPAC Name | 4-hexyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbaldehyde |
SMILES | CCCCCCC1=C(SC(C=O)=C1)B1OC(C)(C)C(C)(C)O1 |
INCHI Code | InChI=1S/C17H27BO3S/c1-6-7-8-9-10-13-11-14(12-19)22-15(13)18-20-16(2,3)17(4,5)21-18/h11-12H,6-10H2,1-5H3 |
Asymmetric atoms | 0 |
LogP | 5.7717 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.7058824 |
Concept Codes | Aldehyde, Heterocycle, Heteroaromatic, Sulfide, Methyl, Boronic ester, Pinacol boronate, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic, 1,3,2-Dioxaborolane |