N-methyl-1-(5-(morpholinomethyl)furan-2-yl)methanamine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F757836 |
---|---|
Product Name | N-methyl-1-(5-(morpholinomethyl)furan-2-yl)methanamine |
Other Names | 4-{5-[(Methylamino)methyl]furan-2-ylmethyl}morpholine |
CAS | 893741-66-7 |
Purity | 98% |
Molecular weight | 210.277 |
IUPAC Name | methyl({5-[(morpholin-4-yl)methyl]furan-2-yl}methyl)amine |
SMILES | CNCC1=CC=C(CN2CCOCC2)O1 |
INCHI Code | InChI=1S/C11H18N2O2/c1-12-8-10-2-3-11(15-10)9-13-4-6-14-7-5-13/h2-3,12H,4-9H2,1H3 |
Asymmetric atoms | 0 |
LogP | 0.23473872 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.6363636 |
Concept Codes | Ether, Heterocycle, Heteroaromatic, Secondary amine, Tertiary amine, Amine (P+S+T), N-methyl, Diamine, 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heterocycle, Furan, Morpholine, Cyclic, Aromatic, 1,4-Oxazinane, Oxazinane |