2-Amino-N-(3,5-dimethylphenyl)acetamide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F755514 |
---|---|
Product Name | 2-Amino-N-(3,5-dimethylphenyl)acetamide |
CAS | 938337-14-5 |
Purity | 98% |
Molecular weight | 178.235 |
IUPAC Name | 2-amino-N-(3,5-dimethylphenyl)acetamide |
SMILES | CC1=CC(NC(=O)CN)=CC(C)=C1 |
INCHI Code | InChI=1S/C10H14N2O/c1-7-3-8(2)5-9(4-7)12-10(13)6-11/h3-5H,6,11H2,1-2H3,(H,12,13) |
Asymmetric atoms | 0 |
LogP | 1.3136691 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.3 |
Concept Codes | Phenyl, Amide, Primary amine, Amine (P+S+T), Methyl, Tolyl, Dimethyl, Cyclic, Aromatic |