Methyl 2-(2-(2,4-dichlorophenoxy)acetamido)-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F754948 |
---|---|
Product Name | Methyl 2-(2-(2,4-dichlorophenoxy)acetamido)-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
CAS | 505096-56-0 |
Purity | 97% |
Molecular weight | 473.37 |
IUPAC Name | methyl 2-[2-(2,4-dichlorophenoxy)acetamido]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
SMILES | CCN(CC)C(=O)C1=C(C)C(C(=O)OC)=C(NC(=O)COC2=C(Cl)C=C(Cl)C=C2)S1 |
INCHI Code | InChI=1S/C20H22Cl2N2O5S/c1-5-24(6-2)19(26)17-11(3)16(20(27)28-4)18(30-17)23-15(25)10-29-14-8-7-12(21)9-13(14)22/h7-9H,5-6,10H2,1-4H3,(H,23,25) |
Asymmetric atoms | 0 |
LogP | 5.193333 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.35 |
Concept Codes | Phenyl, Ester, Ether, Heterocycle, Heteroaromatic, Amide, Sulfide, Chloro, Halo, Methyl, 1,3-Dichlorobenzene, 5-Membered heteroaromatic, 5-Membered heterocycle, Dichlorobenzene, Thiophene, Cyclic, Aromatic |