1-Bromophenazine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F754674 |
---|---|
Product Name | 1-Bromophenazine |
CAS | 3331-27-9 |
Purity | 98% |
Molecular weight | 259.106 |
IUPAC Name | 1-bromophenazine |
SMILES | BrC1=CC=CC2=NC3=CC=CC=C3N=C12 |
INCHI Code | InChI=1S/C12H7BrN2/c13-8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7H |
Asymmetric atoms | 0 |
LogP | 3.8290083 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.0 |
Concept Codes | Heterocycle, Heteroaromatic, Bromo, Halo, 6-Membered heteroaromatic, 6-Membered heterocycle, Cyclic, Aromatic |