(5-(Difluoromethoxy)pyridin-2-yl)methanol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F754005 |
---|---|
Product Name | (5-(Difluoromethoxy)pyridin-2-yl)methanol |
CAS | 864757-81-3 |
Purity | 98% |
Molecular weight | 175.135 |
IUPAC Name | [5-(difluoromethoxy)pyridin-2-yl]methanol |
SMILES | OCC1=NC=C(OC(F)F)C=C1 |
INCHI Code | InChI=1S/C7H7F2NO2/c8-7(9)12-6-2-1-5(4-11)10-3-6/h1-3,7,11H,4H2 |
Asymmetric atoms | 0 |
LogP | 0.8387825 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.2857143 |
Concept Codes | Aliphatic alcohol, Ether, Heterocycle, Heteroaromatic, Fluoro, Halo, Difluoromethyl, Difluoromethoxy, Difluoromethoxy, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |