6-(Cyclobutylmethoxy)nicotinonitrile
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F752494 |
---|---|
Product Name | 6-(Cyclobutylmethoxy)nicotinonitrile |
CAS | 1235441-52-7 |
Purity | 97% |
Molecular weight | 188.23 |
IUPAC Name | 6-(cyclobutylmethoxy)pyridine-3-carbonitrile |
SMILES | N#CC1=CN=C(OCC2CCC2)C=C1 |
INCHI Code | InChI=1S/C11H12N2O/c12-6-10-4-5-11(13-7-10)14-8-9-2-1-3-9/h4-5,7,9H,1-3,8H2 |
Asymmetric atoms | 0 |
LogP | 2.2736018 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.45454547 |
Concept Codes | Ether, Heterocycle, Heteroaromatic, Nitrile, 6-Membered heteroaromatic, 6-Membered heterocycle, Cyclobutane, Pyridine, Cyclic, Aromatic |