5,7-Dinitro-1,2,3,4-tetrahydronaphthalene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F752298 |
---|---|
Product Name | 5,7-Dinitro-1,2,3,4-tetrahydronaphthalene |
CAS | 51522-30-6 |
Purity | 98% |
Molecular weight | 222.2 |
IUPAC Name | 5,7-dinitro-1,2,3,4-tetrahydronaphthalene |
SMILES | [O-][N+](=O)C1=CC(=C2CCCCC2=C1)[N+]([O-])=O |
INCHI Code | InChI=1S/C10H10N2O4/c13-11(14)8-5-7-3-1-2-4-9(7)10(6-8)12(15)16/h5-6H,1-4H2 |
Asymmetric atoms | 0 |
LogP | 3.3054683 |
H bond acceptors | 4 |
H bond donors | 0 |
fsp3 | 0.4 |
Concept Codes | Nitro, Cyclic, Aromatic, Tetralin |