2-(P-tolyl)quinoline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F751008 |
---|---|
Product Name | 2-(P-tolyl)quinoline |
CAS | 24667-94-5 |
Purity | 95+% |
Molecular weight | 219.287 |
IUPAC Name | 2-(4-methylphenyl)quinoline |
SMILES | CC1=CC=C(C=C1)C1=NC2=CC=CC=C2C=C1 |
INCHI Code | InChI=1S/C16H13N/c1-12-6-8-14(9-7-12)16-11-10-13-4-2-3-5-15(13)17-16/h2-11H,1H3 |
Asymmetric atoms | 0 |
LogP | 4.6773977 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.0625 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, Methyl, Tolyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Quinoline, Cyclic, Aromatic |