4-butyl-3-methyl-4,5-dihydro-1H-1,2,4-triazole-5-thione
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F749255 |
---|---|
Product Name | 4-butyl-3-methyl-4,5-dihydro-1H-1,2,4-triazole-5-thione |
CAS | 19796-37-3 |
Purity | 95% |
Molecular weight | 171.26 |
IUPAC Name | 4-butyl-3-methyl-4,5-dihydro-1H-1,2,4-triazole-5-thione |
SMILES | CCCCN1C(C)=NNC1=S |
INCHI Code | InChI=1S/C7H13N3S/c1-3-4-5-10-6(2)8-9-7(10)11/h3-5H2,1-2H3,(H,9,11) |
Asymmetric atoms | 0 |
LogP | 1.8775862 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.71428573 |
Concept Codes | Heterocycle, Heteroaromatic, Methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Cyclic, Aromatic, 1,2,4-Triazole |